C17H22N2O2 — CID 5337904
(2E,4E)-5-(dimethylamino)-1-[5-[(1E,3E)-4-(dimethylamino)buta-1,3-dienyl]furan-2-yl]penta-2,4-dien-1-one (PubChem CID 5337904) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (2E,4E)-5-(dimethylamino)-1-[5-[(1E,3E)-4-(dimethylamino)buta-1,3-dienyl]furan-2-yl]penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(dimethylamino)-1-[5-[(1E,3E)-4-(dimethylamino)buta-1,3-dienyl]furan-2-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 5337904 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (2E,4E)-5-(dimethylamino)-1-[5-[(1E,3E)-4-(dimethylamino)buta-1,3-dienyl]furan-2-yl]penta-2,4-dien-1-one |
| SMILES | CN(C)/C=C/C=C/C(=O)c1ccc(/C=C/C=C/N(C)C)o1 |
| InChI | InChI=1S/C17H22N2O2/c1-18(2)13-7-5-9-15-11-12-17(21-15)16(20)10-6-8-14-19(3)4/h5-14H,1-4H3/b9-5+,10-6+,13-7+,14-8+ |
| InChIKey | OBRGHJYOEHTECD-UUHARDOTSA-N |
| XLogP | 3.18 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|