About 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole
6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole (PubChem CID 53379083) has the molecular formula C19H19N5O2
and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole |
| PubChem CID | 53379083 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole |
| SMILES | COc1ccc(CCn2cc(-c3ccc4nc[nH]c4c3)nn2)cc1OC |
| InChI | InChI=1S/C19H19N5O2/c1-25-18-6-3-13(9-19(18)26-2)7-8-24-11-17(22-23-24)14-4-5-15-16(10-14)21-12-20-15/h3-6,9-12H,7-8H2,1-2H3,(H,20,21) |
| InChIKey | WUSACXJBMWPPPL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole?
The IUPAC name of 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole (CID 53379083) is 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole.
What is the SMILES notation for 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole?
The canonical SMILES for 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole is COc1ccc(CCn2cc(-c3ccc4nc[nH]c4c3)nn2)cc1OC.
What is the InChIKey of 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole?
The InChIKey is WUSACXJBMWPPPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O2/c1-25-18-6-3-13(9-19(18)26-2)7-8-24-11-17(22-23-24)14-4-5-15-16(10-14)21-12-20-15/h3-6,9-12H,7-8H2,1-2H3,(H,20,21).
What are the key properties of 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole?
6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole has a molecular weight of 349.39 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]-1H-benzimidazole is sourced from PubChem (CID 53379083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).