C24H29N3O — CID 53379134
3,6,8,14-tetramethyl-8-(6-methyl-3-pyridinyl)-7-oxa-3,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene (PubChem CID 53379134) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 3,6,8,14-tetramethyl-8-(6-methyl-3-pyridinyl)-7-oxa-3,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene.
| Compound Name | 3,6,8,14-tetramethyl-8-(6-methyl-3-pyridinyl)-7-oxa-3,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 53379134 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 3,6,8,14-tetramethyl-8-(6-methyl-3-pyridinyl)-7-oxa-3,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene |
| SMILES | Cc1ccc2c(c1)c1c3n2CC(C)(c2ccc(C)nc2)OC(C)C3CN(C)C1 |
| InChI | InChI=1S/C24H29N3O/c1-15-6-9-22-19(10-15)21-13-26(5)12-20-17(3)28-24(4,14-27(22)23(20)21)18-8-7-16(2)25-11-18/h6-11,17,20H,12-14H2,1-5H3 |
| InChIKey | BIFJMWVDVMEERH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |