C26H32N8O2 — CID 53379237
7-cyclopentyl-N,N-dimethyl-2-[[5-(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 53379237) has the molecular formula C26H32N8O2 and a molecular weight of 488.60 g/mol. Its IUPAC name is 7-cyclopentyl-N,N-dimethyl-2-[[5-(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclopentyl-N,N-dimethyl-2-[[5-(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 53379237 |
| Molecular Formula | C26H32N8O2 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 7-cyclopentyl-N,N-dimethyl-2-[[5-(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(N4CCN5CCCC5C4=O)cn3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C26H32N8O2/c1-31(2)24(35)21-14-17-15-28-26(30-23(17)34(21)18-6-3-4-7-18)29-22-10-9-19(16-27-22)33-13-12-32-11-5-8-20(32)25(33)36/h9-10,14-16,18,20H,3-8,11-13H2,1-2H3,(H,27,28,29,30) |
| InChIKey | UHLMUTYUXRIVIZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |