About 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine
4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine (PubChem CID 53379346) has the molecular formula C15H12Cl2FN3O
and a molecular weight of 340.19 g/mol. Its IUPAC name is 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine.
Molecular Properties
| Compound Name | 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine |
| PubChem CID | 53379346 |
| Molecular Formula | C15H12Cl2FN3O |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine |
| SMILES | C[C@@H](Oc1c(N)ncc2[nH]ccc12)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H12Cl2FN3O/c1-7(12-9(16)2-3-10(18)13(12)17)22-14-8-4-5-20-11(8)6-21-15(14)19/h2-7,20H,1H3,(H2,19,21)/t7-/m1/s1 |
| InChIKey | DVIQAWZBFCLJPO-SSDOTTSWSA-N |
| XLogP | 4.73 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine?
The IUPAC name of 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine (CID 53379346) is 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine.
What is the SMILES notation for 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine?
The canonical SMILES for 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine is C[C@@H](Oc1c(N)ncc2[nH]ccc12)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine?
The InChIKey is DVIQAWZBFCLJPO-SSDOTTSWSA-N. The full InChI is InChI=1S/C15H12Cl2FN3O/c1-7(12-9(16)2-3-10(18)13(12)17)22-14-8-4-5-20-11(8)6-21-15(14)19/h2-7,20H,1H3,(H2,19,21)/t7-/m1/s1.
What are the key properties of 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine?
4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine has a molecular weight of 340.19 g/mol, XLogP of 4.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1H-pyrrolo[2,3-c]pyridin-5-amine is sourced from PubChem (CID 53379346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).