About 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid
4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 53379429) has the molecular formula C19H14F2N2O3S
and a molecular weight of 388.40 g/mol. Its IUPAC name is 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid |
| PubChem CID | 53379429 |
| Molecular Formula | C19H14F2N2O3S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1cnccc1C(=O)Nc1scc(-c2ccc(C)c(F)c2F)c1C(=O)O |
| InChI | InChI=1S/C19H14F2N2O3S/c1-9-3-4-12(16(21)15(9)20)13-8-27-18(14(13)19(25)26)23-17(24)11-5-6-22-7-10(11)2/h3-8H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | UPKRMBIHHMOGMB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid?
The IUPAC name of 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid (CID 53379429) is 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid.
What is the SMILES notation for 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid?
The canonical SMILES for 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid is Cc1cnccc1C(=O)Nc1scc(-c2ccc(C)c(F)c2F)c1C(=O)O.
What is the InChIKey of 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid?
The InChIKey is UPKRMBIHHMOGMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N2O3S/c1-9-3-4-12(16(21)15(9)20)13-8-27-18(14(13)19(25)26)23-17(24)11-5-6-22-7-10(11)2/h3-8H,1-2H3,(H,23,24)(H,25,26).
What are the key properties of 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid?
4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid has a molecular weight of 388.40 g/mol, XLogP of 4.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-difluoro-4-methylphenyl)-2-[(3-methylpyridine-4-carbonyl)amino]thiophene-3-carboxylic acid is sourced from PubChem (CID 53379429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).