About 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline
7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline (PubChem CID 53379480) has the molecular formula C26H22N2O3
and a molecular weight of 410.47 g/mol. Its IUPAC name is 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline.
Molecular Properties
| Compound Name | 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline |
| PubChem CID | 53379480 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline |
| SMILES | COc1cc(-c2nccc3ccc(-c4ccc5[nH]ccc5c4)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H22N2O3/c1-29-23-14-20(15-24(30-2)26(23)31-3)25-21-13-18(5-4-16(21)8-11-28-25)17-6-7-22-19(12-17)9-10-27-22/h4-15,27H,1-3H3 |
| InChIKey | WBKMGZIPLUZPPR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline?
The IUPAC name of 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline (CID 53379480) is 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline.
What is the SMILES notation for 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline?
The canonical SMILES for 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline is COc1cc(-c2nccc3ccc(-c4ccc5[nH]ccc5c4)cc23)cc(OC)c1OC.
What is the InChIKey of 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline?
The InChIKey is WBKMGZIPLUZPPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O3/c1-29-23-14-20(15-24(30-2)26(23)31-3)25-21-13-18(5-4-16(21)8-11-28-25)17-6-7-22-19(12-17)9-10-27-22/h4-15,27H,1-3H3.
What are the key properties of 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline?
7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline has a molecular weight of 410.47 g/mol, XLogP of 6.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1H-indol-5-yl)-1-(3,4,5-trimethoxyphenyl)isoquinoline is sourced from PubChem (CID 53379480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).