C8H8F5NO4 — CID 533796
1-O-ethyl 2-O-methyl 3,3-difluoro-2-(trifluoromethyl)aziridine-1,2-dicarboxylate (PubChem CID 533796) has the molecular formula C8H8F5NO4 and a molecular weight of 277.14 g/mol. Its IUPAC name is 1-O-ethyl 2-O-methyl 3,3-difluoro-2-(trifluoromethyl)aziridine-1,2-dicarboxylate.
| Compound Name | 1-O-ethyl 2-O-methyl 3,3-difluoro-2-(trifluoromethyl)aziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 533796 |
| Molecular Formula | C8H8F5NO4 |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 1-O-ethyl 2-O-methyl 3,3-difluoro-2-(trifluoromethyl)aziridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)N1C(F)(F)C1(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C8H8F5NO4/c1-3-18-5(16)14-6(4(15)17-2,7(9,10)11)8(14,12)13/h3H2,1-2H3 |
| InChIKey | PEZIEUQRBBZGLH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|