About benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate
benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate (PubChem CID 53379620) has the molecular formula C15H18O4
and a molecular weight of 262.30 g/mol. Its IUPAC name is benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate |
| PubChem CID | 53379620 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate |
| SMILES | C=C[C@@H]1CC[C@@H](CC(=O)OCc2ccccc2)OO1 |
| InChI | InChI=1S/C15H18O4/c1-2-13-8-9-14(19-18-13)10-15(16)17-11-12-6-4-3-5-7-12/h2-7,13-14H,1,8-11H2/t13-,14+/m1/s1 |
| InChIKey | WNSBEJYLAVOPGB-KGLIPLIRSA-N |
| XLogP | 2.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate?
The IUPAC name of benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate (CID 53379620) is benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate.
What is the SMILES notation for benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate?
The canonical SMILES for benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate is C=C[C@@H]1CC[C@@H](CC(=O)OCc2ccccc2)OO1.
What is the InChIKey of benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate?
The InChIKey is WNSBEJYLAVOPGB-KGLIPLIRSA-N. The full InChI is InChI=1S/C15H18O4/c1-2-13-8-9-14(19-18-13)10-15(16)17-11-12-6-4-3-5-7-12/h2-7,13-14H,1,8-11H2/t13-,14+/m1/s1.
What are the key properties of benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate?
benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate has a molecular weight of 262.30 g/mol, XLogP of 2.79, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(3S,6S)-6-ethenyldioxan-3-yl]acetate is sourced from PubChem (CID 53379620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).