About 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide
6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide (PubChem CID 53380121) has the molecular formula C17H13N5O3S
and a molecular weight of 367.39 g/mol. Its IUPAC name is 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide.
Molecular Properties
| Compound Name | 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide |
| PubChem CID | 53380121 |
| Molecular Formula | C17H13N5O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide |
| SMILES | NC(=O)c1nccc2c1[nH]c1ccc(S(=O)(=O)Nc3ccccn3)cc12 |
| InChI | InChI=1S/C17H13N5O3S/c18-17(23)16-15-11(6-8-20-16)12-9-10(4-5-13(12)21-15)26(24,25)22-14-3-1-2-7-19-14/h1-9,21H,(H2,18,23)(H,19,22) |
| InChIKey | HTDIOMWIPPPMNP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide?
The IUPAC name of 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide (CID 53380121) is 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide.
What is the SMILES notation for 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide?
The canonical SMILES for 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide is NC(=O)c1nccc2c1[nH]c1ccc(S(=O)(=O)Nc3ccccn3)cc12.
What is the InChIKey of 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide?
The InChIKey is HTDIOMWIPPPMNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5O3S/c18-17(23)16-15-11(6-8-20-16)12-9-10(4-5-13(12)21-15)26(24,25)22-14-3-1-2-7-19-14/h1-9,21H,(H2,18,23)(H,19,22).
What are the key properties of 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide?
6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide has a molecular weight of 367.39 g/mol, XLogP of 2.01, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(pyridin-2-ylsulfamoyl)-9H-pyrido[3,4-b]indole-1-carboxamide is sourced from PubChem (CID 53380121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).