About (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol
(2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol (PubChem CID 5338013) has the molecular formula C21H28N2O2
and a molecular weight of 340.47 g/mol. Its IUPAC name is (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol.
Molecular Properties
| Compound Name | (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol |
| PubChem CID | 5338013 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol |
| SMILES | CCN(CC)CCC/C(=N\O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O2/c1-3-23(4-2)17-11-16-20(22-25)21(24,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15,24-25H,3-4,11,16-17H2,1-2H3/b22-20+ |
| InChIKey | ZELQRYJJSMLNTJ-LSDHQDQOSA-N |
| XLogP | 3.87 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol?
The IUPAC name of (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol (CID 5338013) is (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol.
What is the SMILES notation for (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol?
The canonical SMILES for (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol is CCN(CC)CCC/C(=N\O)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol?
The InChIKey is ZELQRYJJSMLNTJ-LSDHQDQOSA-N. The full InChI is InChI=1S/C21H28N2O2/c1-3-23(4-2)17-11-16-20(22-25)21(24,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15,24-25H,3-4,11,16-17H2,1-2H3/b22-20+.
What are the key properties of (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol?
(2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol has a molecular weight of 340.47 g/mol, XLogP of 3.87, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5-(diethylamino)-2-hydroxyimino-1,1-diphenylpentan-1-ol is sourced from PubChem (CID 5338013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).