C21H25N3O — CID 53380367
2-(3,9-dimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-5-yl)-1-pyridin-4-ylethanol (PubChem CID 53380367) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-(3,9-dimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-5-yl)-1-pyridin-4-ylethanol.
| Compound Name | 2-(3,9-dimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-5-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 53380367 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-(3,9-dimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-5-yl)-1-pyridin-4-ylethanol |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(C)CC3CC(O)c1ccncc1 |
| InChI | InChI=1S/C21H25N3O/c1-14-3-4-19-18(11-14)17-7-10-24(2)13-16(21(17)23-19)12-20(25)15-5-8-22-9-6-15/h3-6,8-9,11,16,20,23,25H,7,10,12-13H2,1-2H3 |
| InChIKey | JTMLAWURSBPROY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |