C20H29NO12S — CID 53380511
methyl 2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 53380511) has the molecular formula C20H29NO12S and a molecular weight of 507.51 g/mol. Its IUPAC name is methyl 2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 53380511 |
| Molecular Formula | C20H29NO12S |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | methyl 2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CSC(C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)N1 |
| InChI | InChI=1S/C20H29NO12S/c1-9(22)29-7-15(30-10(2)23)16(31-11(3)24)17(32-12(4)25)18(33-13(5)26)19-21-14(8-34-19)20(27)28-6/h14-19,21H,7-8H2,1-6H3 |
| InChIKey | PZTNKNOSMWPFON-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|