C38H52N2O24S2 — CID 53380722
(3,4,5,6-tetraacetyloxyoxan-2-yl)methyl 2-acetamido-3-[[2-acetamido-3-oxo-3-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxy]propyl]disulfanyl]propanoate (PubChem CID 53380722) has the molecular formula C38H52N2O24S2 and a molecular weight of 984.96 g/mol. Its IUPAC name is (3,4,5,6-tetraacetyloxyoxan-2-yl)methyl 2-acetamido-3-[[2-acetamido-3-oxo-3-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxy]propyl]disulfanyl]propanoate.
| Compound Name | (3,4,5,6-tetraacetyloxyoxan-2-yl)methyl 2-acetamido-3-[[2-acetamido-3-oxo-3-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxy]propyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 53380722 |
| Molecular Formula | C38H52N2O24S2 |
| Molecular Weight | 984.96 g/mol |
| Exact Mass | 984.24 |
| IUPAC Name | (3,4,5,6-tetraacetyloxyoxan-2-yl)methyl 2-acetamido-3-[[2-acetamido-3-oxo-3-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxy]propyl]disulfanyl]propanoate |
| SMILES | CC(=O)NC(CSSCC(NC(C)=O)C(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O)C(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C38H52N2O24S2/c1-15(41)39-25(35(51)53-11-27-29(55-17(3)43)31(57-19(5)45)33(59-21(7)47)37(63-27)61-23(9)49)13-65-66-14-26(40-16(2)42)36(52)54-12-28-30(56-18(4)44)32(58-20(6)46)34(60-22(8)48)38(64-28)62-24(10)50/h25-34,37-38H,11-14H2,1-10H3,(H,39,41)(H,40,42) |
| InChIKey | VBVQIGSQFONYBC-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 339.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.96 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 26 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|