C18H15F2N3O3 — CID 53380808
4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]benzaldehyde (PubChem CID 53380808) has the molecular formula C18H15F2N3O3 and a molecular weight of 359.33 g/mol. Its IUPAC name is 4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]benzaldehyde.
| Compound Name | 4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 53380808 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCC(O)(Cn2cncn2)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H15F2N3O3/c19-14-3-6-16(17(20)7-14)18(25,9-23-12-21-11-22-23)10-26-15-4-1-13(8-24)2-5-15/h1-8,11-12,25H,9-10H2 |
| InChIKey | WEPPVVMXIFHLMC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|