C26H23F6N2OP — CID 53380955
(1S,2S)-1-(3-anthracen-9-yl-4,5-dihydroimidazol-1-ium-1-yl)-2,3-dihydro-1H-inden-2-ol hexafluorophosphate (PubChem CID 53380955) has the molecular formula C26H23F6N2OP and a molecular weight of 524.45 g/mol. Its IUPAC name is (1S,2S)-1-(3-anthracen-9-yl-4,5-dihydroimidazol-1-ium-1-yl)-2,3-dihydro-1H-inden-2-ol hexafluorophosphate.
| Compound Name | (1S,2S)-1-(3-anthracen-9-yl-4,5-dihydroimidazol-1-ium-1-yl)-2,3-dihydro-1H-inden-2-ol hexafluorophosphate |
|---|---|
| PubChem CID | 53380955 |
| Molecular Formula | C26H23F6N2OP |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (1S,2S)-1-(3-anthracen-9-yl-4,5-dihydroimidazol-1-ium-1-yl)-2,3-dihydro-1H-inden-2-ol hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.O[C@H]1Cc2ccccc2[C@@H]1[N+]1=CN(c2c3ccccc3cc3ccccc23)CC1 |
| InChI | InChI=1S/C26H23N2O.F6P/c29-24-16-20-9-3-6-12-23(20)26(24)28-14-13-27(17-28)25-21-10-4-1-7-18(21)15-19-8-2-5-11-22(19)25;1-7(2,3,4,5)6/h1-12,15,17,24,26,29H,13-14,16H2;/q+1;-1/t24-,26-;/m0./s1 |
| InChIKey | FQRVMDINZQMQBI-YLQNXEDKSA-N |
| XLogP | 7.89 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|