C31H33NO8S — CID 53381309
tert-butyl (1'S,3'S,4R,4'R,5R,5'S,6'R)-3'-(benzenesulfonyl)-5',6'-dihydroxy-4,5-diphenylspiro[1,3-dioxolane-2,2'-7-azabicyclo[2.2.1]heptane]-7'-carboxylate (PubChem CID 53381309) has the molecular formula C31H33NO8S and a molecular weight of 579.67 g/mol. Its IUPAC name is tert-butyl (1'S,3'S,4R,4'R,5R,5'S,6'R)-3'-(benzenesulfonyl)-5',6'-dihydroxy-4,5-diphenylspiro[1,3-dioxolane-2,2'-7-azabicyclo[2.2.1]heptane]-7'-carboxylate.
| Compound Name | tert-butyl (1'S,3'S,4R,4'R,5R,5'S,6'R)-3'-(benzenesulfonyl)-5',6'-dihydroxy-4,5-diphenylspiro[1,3-dioxolane-2,2'-7-azabicyclo[2.2.1]heptane]-7'-carboxylate |
|---|---|
| PubChem CID | 53381309 |
| Molecular Formula | C31H33NO8S |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | tert-butyl (1'S,3'S,4R,4'R,5R,5'S,6'R)-3'-(benzenesulfonyl)-5',6'-dihydroxy-4,5-diphenylspiro[1,3-dioxolane-2,2'-7-azabicyclo[2.2.1]heptane]-7'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2[C@H](O)[C@H](O)[C@H]1C1(O[C@H](c3ccccc3)[C@@H](c3ccccc3)O1)[C@H]2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H33NO8S/c1-30(2,3)40-29(35)32-22-23(33)24(34)27(32)31(28(22)41(36,37)21-17-11-6-12-18-21)38-25(19-13-7-4-8-14-19)26(39-31)20-15-9-5-10-16-20/h4-18,22-28,33-34H,1-3H3/t22-,23+,24+,25-,26-,27+,28+/m1/s1 |
| InChIKey | PKSQBYCBPRPUOT-GFYXSNKXSA-N |
| XLogP | 3.78 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |