About 4-ethynyl-5-methylideneocta-1,7-diyne
4-ethynyl-5-methylideneocta-1,7-diyne (PubChem CID 53381528) has the molecular formula C11H10
and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-ethynyl-5-methylideneocta-1,7-diyne.
Molecular Properties
| Compound Name | 4-ethynyl-5-methylideneocta-1,7-diyne |
| PubChem CID | 53381528 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 4-ethynyl-5-methylideneocta-1,7-diyne |
| SMILES | C#CCC(=C)C(C#C)CC#C |
| InChI | InChI=1S/C11H10/c1-5-8-10(4)11(7-3)9-6-2/h1-3,11H,4,8-9H2 |
| InChIKey | QVDOLWQTRGETRZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-5-methylideneocta-1,7-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-5-methylideneocta-1,7-diyne?
The IUPAC name of 4-ethynyl-5-methylideneocta-1,7-diyne (CID 53381528) is 4-ethynyl-5-methylideneocta-1,7-diyne.
What is the SMILES notation for 4-ethynyl-5-methylideneocta-1,7-diyne?
The canonical SMILES for 4-ethynyl-5-methylideneocta-1,7-diyne is C#CCC(=C)C(C#C)CC#C.
What is the InChIKey of 4-ethynyl-5-methylideneocta-1,7-diyne?
The InChIKey is QVDOLWQTRGETRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10/c1-5-8-10(4)11(7-3)9-6-2/h1-3,11H,4,8-9H2.
What are the key properties of 4-ethynyl-5-methylideneocta-1,7-diyne?
4-ethynyl-5-methylideneocta-1,7-diyne has a molecular weight of 142.20 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-5-methylideneocta-1,7-diyne is sourced from PubChem (CID 53381528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).