C17H26O2S — CID 53381640
S-tert-butyl (3aR,5Z,9R,9aR)-3a-methyl-3-oxo-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene-9-carbothioate (PubChem CID 53381640) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is S-tert-butyl (3aR,5Z,9R,9aR)-3a-methyl-3-oxo-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene-9-carbothioate.
| Compound Name | S-tert-butyl (3aR,5Z,9R,9aR)-3a-methyl-3-oxo-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene-9-carbothioate |
|---|---|
| PubChem CID | 53381640 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | S-tert-butyl (3aR,5Z,9R,9aR)-3a-methyl-3-oxo-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene-9-carbothioate |
| SMILES | CC(C)(C)SC(=O)[C@@H]1CC/C=C\C[C@@]2(C)C(=O)CC[C@H]12 |
| InChI | InChI=1S/C17H26O2S/c1-16(2,3)20-15(19)12-8-6-5-7-11-17(4)13(12)9-10-14(17)18/h5,7,12-13H,6,8-11H2,1-4H3/b7-5-/t12-,13-,17-/m1/s1 |
| InChIKey | KRTNZHDVMKOUJC-JBWZXEEISA-N |
| XLogP | 4.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|