C13H20O7 — CID 53381683
(4S,5S)-5-[(2S,5R)-2,5-dimethoxy-2H-furan-5-yl]-4-(dimethoxymethyl)oxolan-2-one (PubChem CID 53381683) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is (4S,5S)-5-[(2S,5R)-2,5-dimethoxy-2H-furan-5-yl]-4-(dimethoxymethyl)oxolan-2-one.
| Compound Name | (4S,5S)-5-[(2S,5R)-2,5-dimethoxy-2H-furan-5-yl]-4-(dimethoxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 53381683 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (4S,5S)-5-[(2S,5R)-2,5-dimethoxy-2H-furan-5-yl]-4-(dimethoxymethyl)oxolan-2-one |
| SMILES | COC(OC)[C@H]1CC(=O)O[C@@H]1[C@@]1(OC)C=C[C@@H](OC)O1 |
| InChI | InChI=1S/C13H20O7/c1-15-10-5-6-13(18-4,20-10)11-8(7-9(14)19-11)12(16-2)17-3/h5-6,8,10-12H,7H2,1-4H3/t8-,10-,11-,13+/m0/s1 |
| InChIKey | ZQHYZRAYPVBQAV-KYVBTAMFSA-N |
| XLogP | 0.44 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|