C23H40O4Si — CID 53381846
(1'R,2R,3'R,4S,7aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-ethenyl-2-(methoxymethoxy)spiro[1,2,5,6,7,7a-hexahydroindene-4,2'-cyclopentane]-1'-ol (PubChem CID 53381846) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (1'R,2R,3'R,4S,7aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-ethenyl-2-(methoxymethoxy)spiro[1,2,5,6,7,7a-hexahydroindene-4,2'-cyclopentane]-1'-ol.
| Compound Name | (1'R,2R,3'R,4S,7aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-ethenyl-2-(methoxymethoxy)spiro[1,2,5,6,7,7a-hexahydroindene-4,2'-cyclopentane]-1'-ol |
|---|---|
| PubChem CID | 53381846 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (1'R,2R,3'R,4S,7aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-ethenyl-2-(methoxymethoxy)spiro[1,2,5,6,7,7a-hexahydroindene-4,2'-cyclopentane]-1'-ol |
| SMILES | C=C[C@]1(O)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]12CCC[C@H]1C[C@@H](OCOC)C=C12 |
| InChI | InChI=1S/C23H40O4Si/c1-8-22(24)13-11-20(27-28(6,7)21(2,3)4)23(22)12-9-10-17-14-18(15-19(17)23)26-16-25-5/h8,15,17-18,20,24H,1,9-14,16H2,2-7H3/t17-,18+,20+,22-,23-/m0/s1 |
| InChIKey | DLYAKMWPITZCCL-XDSOEWGTSA-N |
| XLogP | 5.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|