C26H31FO4Si — CID 53382247
(3aR,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-2,2,3a-trimethyl-6aH-cyclopenta[d][1,3]dioxol-4-one (PubChem CID 53382247) has the molecular formula C26H31FO4Si and a molecular weight of 454.61 g/mol. Its IUPAC name is (3aR,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-2,2,3a-trimethyl-6aH-cyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-2,2,3a-trimethyl-6aH-cyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 53382247 |
| Molecular Formula | C26H31FO4Si |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (3aR,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-2,2,3a-trimethyl-6aH-cyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]2C(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)=C(F)C(=O)[C@]2(C)O1 |
| InChI | InChI=1S/C26H31FO4Si/c1-24(2,3)32(18-13-9-7-10-14-18,19-15-11-8-12-16-19)29-17-20-21(27)22(28)26(6)23(20)30-25(4,5)31-26/h7-16,23H,17H2,1-6H3/t23-,26+/m1/s1 |
| InChIKey | RPLYJOXQCVZIJX-BVAGGSTKSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|