C16H18FNO5 — CID 53382598
methyl 2-[(2S,3S,6S)-3-[(3-fluorobenzoyl)amino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 53382598) has the molecular formula C16H18FNO5 and a molecular weight of 323.32 g/mol. Its IUPAC name is methyl 2-[(2S,3S,6S)-3-[(3-fluorobenzoyl)amino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,6S)-3-[(3-fluorobenzoyl)amino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 53382598 |
| Molecular Formula | C16H18FNO5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl 2-[(2S,3S,6S)-3-[(3-fluorobenzoyl)amino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=C[C@H](NC(=O)c2cccc(F)c2)[C@@H](CO)O1 |
| InChI | InChI=1S/C16H18FNO5/c1-22-15(20)8-12-5-6-13(14(9-19)23-12)18-16(21)10-3-2-4-11(17)7-10/h2-7,12-14,19H,8-9H2,1H3,(H,18,21)/t12-,13+,14-/m1/s1 |
| InChIKey | UXLMIYMJGKOVCW-HZSPNIEDSA-N |
| XLogP | 0.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|