C14H17N3O5 — CID 53382608
methyl 2-[(2S,3S,6R)-2-(hydroxymethyl)-3-(pyrazine-2-carbonylamino)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 53382608) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl 2-[(2S,3S,6R)-2-(hydroxymethyl)-3-(pyrazine-2-carbonylamino)-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,6R)-2-(hydroxymethyl)-3-(pyrazine-2-carbonylamino)-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 53382608 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl 2-[(2S,3S,6R)-2-(hydroxymethyl)-3-(pyrazine-2-carbonylamino)-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C=C[C@H](NC(=O)c2cnccn2)[C@@H](CO)O1 |
| InChI | InChI=1S/C14H17N3O5/c1-21-13(19)6-9-2-3-10(12(8-18)22-9)17-14(20)11-7-15-4-5-16-11/h2-5,7,9-10,12,18H,6,8H2,1H3,(H,17,20)/t9-,10-,12+/m0/s1 |
| InChIKey | FQIWODGEPNRAQM-JBLDHEPKSA-N |
| XLogP | -0.55 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|