C26H35N3O5 — CID 53382784
2-[(3R,6aS,8S,10aS)-3-hydroxy-1-[(3-pyridin-4-ylphenyl)methyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 53382784) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-[(3R,6aS,8S,10aS)-3-hydroxy-1-[(3-pyridin-4-ylphenyl)methyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(3R,6aS,8S,10aS)-3-hydroxy-1-[(3-pyridin-4-ylphenyl)methyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 53382784 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 2-[(3R,6aS,8S,10aS)-3-hydroxy-1-[(3-pyridin-4-ylphenyl)methyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1CC[C@H]2[C@@H](COC[C@H](O)CN2Cc2cccc(-c3ccncc3)c2)O1 |
| InChI | InChI=1S/C26H35N3O5/c1-32-12-11-28-26(31)14-23-5-6-24-25(34-23)18-33-17-22(30)16-29(24)15-19-3-2-4-21(13-19)20-7-9-27-10-8-20/h2-4,7-10,13,22-25,30H,5-6,11-12,14-18H2,1H3,(H,28,31)/t22-,23+,24+,25-/m1/s1 |
| InChIKey | SKGYYFBYLQDJLU-WSOYEBOPSA-N |
| XLogP | 2.01 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|