About dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate
dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate (PubChem CID 53382851) has the molecular formula C20H23NO6S
and a molecular weight of 405.47 g/mol. Its IUPAC name is dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate |
| PubChem CID | 53382851 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1ccccc1NS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H23NO6S/c1-12-10-13(2)18(14(3)11-12)28(24,25)21-16-9-7-6-8-15(16)17(19(22)26-4)20(23)27-5/h6-11,17,21H,1-5H3 |
| InChIKey | HSVWUQQMRDMHLR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate?
The IUPAC name of dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate (CID 53382851) is dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate.
What is the SMILES notation for dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate?
The canonical SMILES for dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate is COC(=O)C(C(=O)OC)c1ccccc1NS(=O)(=O)c1c(C)cc(C)cc1C.
What is the InChIKey of dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate?
The InChIKey is HSVWUQQMRDMHLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO6S/c1-12-10-13(2)18(14(3)11-12)28(24,25)21-16-9-7-6-8-15(16)17(19(22)26-4)20(23)27-5/h6-11,17,21H,1-5H3.
What are the key properties of dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate?
dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate has a molecular weight of 405.47 g/mol, XLogP of 2.84, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]propanedioate is sourced from PubChem (CID 53382851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).