About N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide
N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 53382895) has the molecular formula C21H19F3N2O2
and a molecular weight of 388.39 g/mol. Its IUPAC name is N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide |
| PubChem CID | 53382895 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1nc(-c2ccc(C(F)(F)F)cc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-2-3-13-25-19(27)17-18(14-7-5-4-6-8-14)28-20(26-17)15-9-11-16(12-10-15)21(22,23)24/h4-12H,2-3,13H2,1H3,(H,25,27) |
| InChIKey | OPCHFKHBCUWFOZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide?
The IUPAC name of N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide (CID 53382895) is N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide is CCCCNC(=O)c1nc(-c2ccc(C(F)(F)F)cc2)oc1-c1ccccc1.
What is the InChIKey of N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide?
The InChIKey is OPCHFKHBCUWFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3N2O2/c1-2-3-13-25-19(27)17-18(14-7-5-4-6-8-14)28-20(26-17)15-9-11-16(12-10-15)21(22,23)24/h4-12H,2-3,13H2,1H3,(H,25,27).
What are the key properties of N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide?
N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide has a molecular weight of 388.39 g/mol, XLogP of 5.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 53382895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).