C21H20F2N2O2 — CID 53382897
2-(2,6-difluorophenyl)-N-pentyl-5-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 53382897) has the molecular formula C21H20F2N2O2 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-pentyl-5-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2,6-difluorophenyl)-N-pentyl-5-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53382897 |
| Molecular Formula | C21H20F2N2O2 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-pentyl-5-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1nc(-c2c(F)cccc2F)oc1-c1ccccc1 |
| InChI | InChI=1S/C21H20F2N2O2/c1-2-3-7-13-24-20(26)18-19(14-9-5-4-6-10-14)27-21(25-18)17-15(22)11-8-12-16(17)23/h4-6,8-12H,2-3,7,13H2,1H3,(H,24,26) |
| InChIKey | VMQYQVBVFMTVNT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|