About 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole
1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole (PubChem CID 53382922) has the molecular formula C25H22Cl2N4
and a molecular weight of 449.39 g/mol. Its IUPAC name is 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole.
Molecular Properties
| Compound Name | 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole |
| PubChem CID | 53382922 |
| Molecular Formula | C25H22Cl2N4 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole |
| SMILES | CC(C)(C)C(c1nc2ccccc2[nH]1)n1c(-c2cc(Cl)cc(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C25H22Cl2N4/c1-25(2,3)22(23-28-18-8-4-5-9-19(18)29-23)31-21-11-7-6-10-20(21)30-24(31)15-12-16(26)14-17(27)13-15/h4-14,22H,1-3H3,(H,28,29) |
| InChIKey | SZHTZCGOTFUODV-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole?
The IUPAC name of 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole (CID 53382922) is 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole.
What is the SMILES notation for 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole?
The canonical SMILES for 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole is CC(C)(C)C(c1nc2ccccc2[nH]1)n1c(-c2cc(Cl)cc(Cl)c2)nc2ccccc21.
What is the InChIKey of 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole?
The InChIKey is SZHTZCGOTFUODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22Cl2N4/c1-25(2,3)22(23-28-18-8-4-5-9-19(18)29-23)31-21-11-7-6-10-20(21)30-24(31)15-12-16(26)14-17(27)13-15/h4-14,22H,1-3H3,(H,28,29).
What are the key properties of 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole?
1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole has a molecular weight of 449.39 g/mol, XLogP of 7.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(3,5-dichlorophenyl)benzimidazole is sourced from PubChem (CID 53382922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).