About N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide
N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide (PubChem CID 53382958) has the molecular formula C20H19N5O
and a molecular weight of 345.41 g/mol. Its IUPAC name is N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide |
| PubChem CID | 53382958 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCNC(=O)c3ccccn3)nc2c1 |
| InChI | InChI=1S/C20H19N5O/c1-13-9-14(2)16-11-15(12-21)19(25-18(16)10-13)23-7-8-24-20(26)17-5-3-4-6-22-17/h3-6,9-11H,7-8H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | PZYQTQKPRYQVQP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide?
The IUPAC name of N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide (CID 53382958) is N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide.
What is the SMILES notation for N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide?
The canonical SMILES for N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide is Cc1cc(C)c2cc(C#N)c(NCCNC(=O)c3ccccn3)nc2c1.
What is the InChIKey of N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide?
The InChIKey is PZYQTQKPRYQVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5O/c1-13-9-14(2)16-11-15(12-21)19(25-18(16)10-13)23-7-8-24-20(26)17-5-3-4-6-22-17/h3-6,9-11H,7-8H2,1-2H3,(H,23,25)(H,24,26).
What are the key properties of N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide?
N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide has a molecular weight of 345.41 g/mol, XLogP of 2.96, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]pyridine-2-carboxamide is sourced from PubChem (CID 53382958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).