About 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide
2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide (PubChem CID 53383122) has the molecular formula C27H25N3O2
and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide |
| PubChem CID | 53383122 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(C1CC1)n1c(=O)c(-c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C27H25N3O2/c1-17-9-8-10-18(2)23(17)29-26(31)25(20-15-16-20)30-22-14-7-6-13-21(22)28-24(27(30)32)19-11-4-3-5-12-19/h3-14,20,25H,15-16H2,1-2H3,(H,29,31) |
| InChIKey | MMHVQCXKVFNTGZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide?
The IUPAC name of 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide (CID 53383122) is 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide.
What is the SMILES notation for 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide?
The canonical SMILES for 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide is Cc1cccc(C)c1NC(=O)C(C1CC1)n1c(=O)c(-c2ccccc2)nc2ccccc21.
What is the InChIKey of 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide?
The InChIKey is MMHVQCXKVFNTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25N3O2/c1-17-9-8-10-18(2)23(17)29-26(31)25(20-15-16-20)30-22-14-7-6-13-21(22)28-24(27(30)32)19-11-4-3-5-12-19/h3-14,20,25H,15-16H2,1-2H3,(H,29,31).
What are the key properties of 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide?
2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide has a molecular weight of 423.52 g/mol, XLogP of 5.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-(2,6-dimethylphenyl)-2-(2-oxo-3-phenylquinoxalin-1-yl)acetamide is sourced from PubChem (CID 53383122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).