C27H25F3N2O3 — CID 53383539
7-[anilino-(2,4-dimethylphenyl)methyl]-2-methylquinolin-8-ol;2,2,2-trifluoroacetic acid (PubChem CID 53383539) has the molecular formula C27H25F3N2O3 and a molecular weight of 482.50 g/mol. Its IUPAC name is 7-[anilino-(2,4-dimethylphenyl)methyl]-2-methylquinolin-8-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 7-[anilino-(2,4-dimethylphenyl)methyl]-2-methylquinolin-8-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53383539 |
| Molecular Formula | C27H25F3N2O3 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 7-[anilino-(2,4-dimethylphenyl)methyl]-2-methylquinolin-8-ol;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C(Nc2ccccc2)c2ccc3ccc(C)nc3c2O)c(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H24N2O.C2HF3O2/c1-16-9-13-21(17(2)15-16)24(27-20-7-5-4-6-8-20)22-14-12-19-11-10-18(3)26-23(19)25(22)28;3-2(4,5)1(6)7/h4-15,24,27-28H,1-3H3;(H,6,7) |
| InChIKey | WQERNUJGZGNYGX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|