C20H21N7O — CID 53383690
4-[4-(4-methylphenyl)piperazin-1-yl]-4,6-dihydrotetrazolo[1,5-a][1,5]benzodiazepin-5-one (PubChem CID 53383690) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)piperazin-1-yl]-4,6-dihydrotetrazolo[1,5-a][1,5]benzodiazepin-5-one.
| Compound Name | 4-[4-(4-methylphenyl)piperazin-1-yl]-4,6-dihydrotetrazolo[1,5-a][1,5]benzodiazepin-5-one |
|---|---|
| PubChem CID | 53383690 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-[4-(4-methylphenyl)piperazin-1-yl]-4,6-dihydrotetrazolo[1,5-a][1,5]benzodiazepin-5-one |
| SMILES | Cc1ccc(N2CCN(C3C(=O)Nc4ccccc4-n4nnnc43)CC2)cc1 |
| InChI | InChI=1S/C20H21N7O/c1-14-6-8-15(9-7-14)25-10-12-26(13-11-25)18-19-22-23-24-27(19)17-5-3-2-4-16(17)21-20(18)28/h2-9,18H,10-13H2,1H3,(H,21,28) |
| InChIKey | LWROVJNCCJWXNT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|