C21H24N2O5 — CID 53383761
1-(4-phenylpiperazin-1-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione (PubChem CID 53383761) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-(4-phenylpiperazin-1-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(4-phenylpiperazin-1-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 53383761 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-(4-phenylpiperazin-1-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1cc(C(=O)C(=O)N2CCN(c3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N2O5/c1-26-17-13-15(14-18(27-2)20(17)28-3)19(24)21(25)23-11-9-22(10-12-23)16-7-5-4-6-8-16/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | XQLNOLLAIJZGQF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|