C19H22N2O6S2 — CID 53383801
2-hydroxy-1-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]-2-phenylethanone (PubChem CID 53383801) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-hydroxy-1-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]-2-phenylethanone.
| Compound Name | 2-hydroxy-1-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 53383801 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-hydroxy-1-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]-2-phenylethanone |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)C(O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H22N2O6S2/c1-28(24,25)16-7-9-17(10-8-16)29(26,27)21-13-11-20(12-14-21)19(23)18(22)15-5-3-2-4-6-15/h2-10,18,22H,11-14H2,1H3 |
| InChIKey | LEYWWVULNSQJBU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |