C30H44N2O4 — CID 53383899
methyl (3S,4aR)-3-[2-(benzylamino)-2-oxoethyl]-6,6-dimethyl-1-octyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53383899) has the molecular formula C30H44N2O4 and a molecular weight of 496.69 g/mol. Its IUPAC name is methyl (3S,4aR)-3-[2-(benzylamino)-2-oxoethyl]-6,6-dimethyl-1-octyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-3-[2-(benzylamino)-2-oxoethyl]-6,6-dimethyl-1-octyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53383899 |
| Molecular Formula | C30H44N2O4 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | methyl (3S,4aR)-3-[2-(benzylamino)-2-oxoethyl]-6,6-dimethyl-1-octyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | CCCCCCCCN1C(=O)[C@H](CC(=O)NCc2ccccc2)C[C@@]2(C(=O)OC)CC(C)(C)CC=C12 |
| InChI | InChI=1S/C30H44N2O4/c1-5-6-7-8-9-13-18-32-25-16-17-29(2,3)22-30(25,28(35)36-4)20-24(27(32)34)19-26(33)31-21-23-14-11-10-12-15-23/h10-12,14-16,24H,5-9,13,17-22H2,1-4H3,(H,31,33)/t24-,30-/m1/s1 |
| InChIKey | PIOSZUIQRPNRCK-AYWVHJORSA-N |
| XLogP | 5.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|