C27H36N2O4 — CID 53383930
methyl (3S,4aR)-1-benzyl-6,6-dimethyl-2-oxo-3-(2-oxo-2-piperidin-1-ylethyl)-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53383930) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is methyl (3S,4aR)-1-benzyl-6,6-dimethyl-2-oxo-3-(2-oxo-2-piperidin-1-ylethyl)-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-1-benzyl-6,6-dimethyl-2-oxo-3-(2-oxo-2-piperidin-1-ylethyl)-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53383930 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | methyl (3S,4aR)-1-benzyl-6,6-dimethyl-2-oxo-3-(2-oxo-2-piperidin-1-ylethyl)-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](CC(=O)N3CCCCC3)C(=O)N(Cc3ccccc3)C1=CCC(C)(C)C2 |
| InChI | InChI=1S/C27H36N2O4/c1-26(2)13-12-22-27(19-26,25(32)33-3)17-21(16-23(30)28-14-8-5-9-15-28)24(31)29(22)18-20-10-6-4-7-11-20/h4,6-7,10-12,21H,5,8-9,13-19H2,1-3H3/t21-,27-/m1/s1 |
| InChIKey | YHNHNNDSJJDHNP-JIPXPUAJSA-N |
| XLogP | 4.30 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |