C26H34N2O4 — CID 53383933
methyl (3S,4aR)-1-benzyl-6,6-dimethyl-2-oxo-3-(2-oxo-2-pyrrolidin-1-ylethyl)-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53383933) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is methyl (3S,4aR)-1-benzyl-6,6-dimethyl-2-oxo-3-(2-oxo-2-pyrrolidin-1-ylethyl)-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-1-benzyl-6,6-dimethyl-2-oxo-3-(2-oxo-2-pyrrolidin-1-ylethyl)-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53383933 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | methyl (3S,4aR)-1-benzyl-6,6-dimethyl-2-oxo-3-(2-oxo-2-pyrrolidin-1-ylethyl)-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](CC(=O)N3CCCC3)C(=O)N(Cc3ccccc3)C1=CCC(C)(C)C2 |
| InChI | InChI=1S/C26H34N2O4/c1-25(2)12-11-21-26(18-25,24(31)32-3)16-20(15-22(29)27-13-7-8-14-27)23(30)28(21)17-19-9-5-4-6-10-19/h4-6,9-11,20H,7-8,12-18H2,1-3H3/t20-,26-/m1/s1 |
| InChIKey | DBVKCOGHAPEGNJ-FQRUVTKNSA-N |
| XLogP | 3.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |