C31H38N2O5 — CID 53383966
methyl (3S,4aR)-1-(furan-2-ylmethyl)-6,6-dimethyl-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53383966) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol. Its IUPAC name is methyl (3S,4aR)-1-(furan-2-ylmethyl)-6,6-dimethyl-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-1-(furan-2-ylmethyl)-6,6-dimethyl-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53383966 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | methyl (3S,4aR)-1-(furan-2-ylmethyl)-6,6-dimethyl-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](CC(=O)N3CCC(c4ccccc4)CC3)C(=O)N(Cc3ccco3)C1=CCC(C)(C)C2 |
| InChI | InChI=1S/C31H38N2O5/c1-30(2)14-11-26-31(21-30,29(36)37-3)19-24(28(35)33(26)20-25-10-7-17-38-25)18-27(34)32-15-12-23(13-16-32)22-8-5-4-6-9-22/h4-11,17,23-24H,12-16,18-21H2,1-3H3/t24-,31-/m1/s1 |
| InChIKey | BBRHZBDPDGWNKW-WBBHLRKXSA-N |
| XLogP | 5.29 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |