C22H28Cl2N2O — CID 53383999
N-benzyl-2-[(3,4-dichlorophenyl)methyl-methylamino]-3-ethylpentanamide (PubChem CID 53383999) has the molecular formula C22H28Cl2N2O and a molecular weight of 407.39 g/mol. Its IUPAC name is N-benzyl-2-[(3,4-dichlorophenyl)methyl-methylamino]-3-ethylpentanamide.
| Compound Name | N-benzyl-2-[(3,4-dichlorophenyl)methyl-methylamino]-3-ethylpentanamide |
|---|---|
| PubChem CID | 53383999 |
| Molecular Formula | C22H28Cl2N2O |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-benzyl-2-[(3,4-dichlorophenyl)methyl-methylamino]-3-ethylpentanamide |
| SMILES | CCC(CC)C(C(=O)NCc1ccccc1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H28Cl2N2O/c1-4-18(5-2)21(22(27)25-14-16-9-7-6-8-10-16)26(3)15-17-11-12-19(23)20(24)13-17/h6-13,18,21H,4-5,14-15H2,1-3H3,(H,25,27) |
| InChIKey | SUULFJPUJWTZEL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |