C27H37N3O7 — CID 53384027
methyl (3S,4aR)-3-[2-(4-ethoxycarbonylpiperazin-1-yl)-2-oxoethyl]-1-(furan-2-ylmethyl)-6,6-dimethyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53384027) has the molecular formula C27H37N3O7 and a molecular weight of 515.61 g/mol. Its IUPAC name is methyl (3S,4aR)-3-[2-(4-ethoxycarbonylpiperazin-1-yl)-2-oxoethyl]-1-(furan-2-ylmethyl)-6,6-dimethyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-3-[2-(4-ethoxycarbonylpiperazin-1-yl)-2-oxoethyl]-1-(furan-2-ylmethyl)-6,6-dimethyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53384027 |
| Molecular Formula | C27H37N3O7 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | methyl (3S,4aR)-3-[2-(4-ethoxycarbonylpiperazin-1-yl)-2-oxoethyl]-1-(furan-2-ylmethyl)-6,6-dimethyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C[C@@H]2C[C@@]3(C(=O)OC)CC(C)(C)CC=C3N(Cc3ccco3)C2=O)CC1 |
| InChI | InChI=1S/C27H37N3O7/c1-5-36-25(34)29-12-10-28(11-13-29)22(31)15-19-16-27(24(33)35-4)18-26(2,3)9-8-21(27)30(23(19)32)17-20-7-6-14-37-20/h6-8,14,19H,5,9-13,15-18H2,1-4H3/t19-,27-/m1/s1 |
| InChIKey | QHJLBTYJNXEADO-XHCCPWGMSA-N |
| XLogP | 3.18 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |