benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate

C17H14O3 — CID 53384053

IUPACbenzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate
SMILESO=C(/C=C1\OCc2ccccc21)OCc1ccccc1
InChIInChI=1S/C17H14O3/c18-17(20-11-13-6-2-1-3-7-13)10-16-15-9-5-4-8-14(15)12-19-16/h1-10H,11-12H2/b16-10-
InChIKeyOSHUEKIIKDVRJX-YBEGLDIGSA-N
MW266.30 g/mol
LogP3.30
Rot. Bonds3

About benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate

benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate (PubChem CID 53384053) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate.

Molecular Properties

Compound Namebenzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate
PubChem CID53384053
Molecular FormulaC17H14O3
Molecular Weight266.30 g/mol
Exact Mass266.09
IUPAC Namebenzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate
SMILESO=C(/C=C1\OCc2ccccc21)OCc1ccccc1
InChIInChI=1S/C17H14O3/c18-17(20-11-13-6-2-1-3-7-13)10-16-15-9-5-4-8-14(15)12-19-16/h1-10H,11-12H2/b16-10-
InChIKeyOSHUEKIIKDVRJX-YBEGLDIGSA-N
XLogP3.30
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.30
LogP ≤ 53.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate?
The IUPAC name of benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate (CID 53384053) is benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate.
What is the SMILES notation for benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate?
The canonical SMILES for benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate is O=C(/C=C1\OCc2ccccc21)OCc1ccccc1.
What is the InChIKey of benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate?
The InChIKey is OSHUEKIIKDVRJX-YBEGLDIGSA-N. The full InChI is InChI=1S/C17H14O3/c18-17(20-11-13-6-2-1-3-7-13)10-16-15-9-5-4-8-14(15)12-19-16/h1-10H,11-12H2/b16-10-.
What are the key properties of benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate?
benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate has a molecular weight of 266.30 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2Z)-2-(3H-2-benzofuran-1-ylidene)acetate is sourced from PubChem (CID 53384053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).