C18H25NO5S — CID 53384088
ethyl 2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]acetate (PubChem CID 53384088) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is ethyl 2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]acetate.
| Compound Name | ethyl 2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]acetate |
|---|---|
| PubChem CID | 53384088 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl 2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1OC2CCCCC2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO5S/c1-3-23-18(20)12-17-19(15-6-4-5-7-16(15)24-17)25(21,22)14-10-8-13(2)9-11-14/h8-11,15-17H,3-7,12H2,1-2H3/t15?,16?,17-/m0/s1 |
| InChIKey | JRDPYMUGXIWUEZ-JCYILVPMSA-N |
| XLogP | 2.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |