C23H27NO5S — CID 53384090
benzyl 2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]acetate (PubChem CID 53384090) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is benzyl 2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]acetate.
| Compound Name | benzyl 2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]acetate |
|---|---|
| PubChem CID | 53384090 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | benzyl 2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N2C3CCCCC3O[C@H]2CC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO5S/c1-17-11-13-19(14-12-17)30(26,27)24-20-9-5-6-10-21(20)29-22(24)15-23(25)28-16-18-7-3-2-4-8-18/h2-4,7-8,11-14,20-22H,5-6,9-10,15-16H2,1H3/t20?,21?,22-/m0/s1 |
| InChIKey | NRZMIYPGIIJRHE-HRTMPFAESA-N |
| XLogP | 3.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |