C17H23NO4S — CID 53384091
1-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]propan-2-one (PubChem CID 53384091) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]propan-2-one.
| Compound Name | 1-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]propan-2-one |
|---|---|
| PubChem CID | 53384091 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1OC2CCCCC2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO4S/c1-12-7-9-14(10-8-12)23(20,21)18-15-5-3-4-6-16(15)22-17(18)11-13(2)19/h7-10,15-17H,3-6,11H2,1-2H3/t15?,16?,17-/m0/s1 |
| InChIKey | BBSZDINBYONUPH-JCYILVPMSA-N |
| XLogP | 2.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |