C22H24FNO4S — CID 53384093
1-(4-fluorophenyl)-2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]ethanone (PubChem CID 53384093) has the molecular formula C22H24FNO4S and a molecular weight of 417.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]ethanone |
|---|---|
| PubChem CID | 53384093 |
| Molecular Formula | C22H24FNO4S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[(2S)-3-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzoxazol-2-yl]ethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C3CCCCC3O[C@H]2CC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H24FNO4S/c1-15-6-12-18(13-7-15)29(26,27)24-19-4-2-3-5-21(19)28-22(24)14-20(25)16-8-10-17(23)11-9-16/h6-13,19,21-22H,2-5,14H2,1H3/t19?,21?,22-/m0/s1 |
| InChIKey | UNPAQNBHMGZKAF-VTLFHKLASA-N |
| XLogP | 4.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |