C18H19N3O3S — CID 53384171
2,5-dioxo-4-propan-2-yl-N-(thiophen-2-ylmethyl)-1,3-dihydro-1,4-benzodiazepine-3-carboxamide (PubChem CID 53384171) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2,5-dioxo-4-propan-2-yl-N-(thiophen-2-ylmethyl)-1,3-dihydro-1,4-benzodiazepine-3-carboxamide.
| Compound Name | 2,5-dioxo-4-propan-2-yl-N-(thiophen-2-ylmethyl)-1,3-dihydro-1,4-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 53384171 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2,5-dioxo-4-propan-2-yl-N-(thiophen-2-ylmethyl)-1,3-dihydro-1,4-benzodiazepine-3-carboxamide |
| SMILES | CC(C)N1C(=O)c2ccccc2NC(=O)C1C(=O)NCc1cccs1 |
| InChI | InChI=1S/C18H19N3O3S/c1-11(2)21-15(16(22)19-10-12-6-5-9-25-12)17(23)20-14-8-4-3-7-13(14)18(21)24/h3-9,11,15H,10H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | SLSMCOUJEKCIKL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|