C16H19N3O3 — CID 53384173
N-cyclopropyl-2,5-dioxo-4-propan-2-yl-1,3-dihydro-1,4-benzodiazepine-3-carboxamide (PubChem CID 53384173) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-cyclopropyl-2,5-dioxo-4-propan-2-yl-1,3-dihydro-1,4-benzodiazepine-3-carboxamide.
| Compound Name | N-cyclopropyl-2,5-dioxo-4-propan-2-yl-1,3-dihydro-1,4-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 53384173 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-cyclopropyl-2,5-dioxo-4-propan-2-yl-1,3-dihydro-1,4-benzodiazepine-3-carboxamide |
| SMILES | CC(C)N1C(=O)c2ccccc2NC(=O)C1C(=O)NC1CC1 |
| InChI | InChI=1S/C16H19N3O3/c1-9(2)19-13(14(20)17-10-7-8-10)15(21)18-12-6-4-3-5-11(12)16(19)22/h3-6,9-10,13H,7-8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | SBUVTNYCITVPEO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|