C19H27N3O3 — CID 53384201
4-tert-butyl-2,5-dioxo-N-pentyl-1,3-dihydro-1,4-benzodiazepine-3-carboxamide (PubChem CID 53384201) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-tert-butyl-2,5-dioxo-N-pentyl-1,3-dihydro-1,4-benzodiazepine-3-carboxamide.
| Compound Name | 4-tert-butyl-2,5-dioxo-N-pentyl-1,3-dihydro-1,4-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 53384201 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 4-tert-butyl-2,5-dioxo-N-pentyl-1,3-dihydro-1,4-benzodiazepine-3-carboxamide |
| SMILES | CCCCCNC(=O)C1C(=O)Nc2ccccc2C(=O)N1C(C)(C)C |
| InChI | InChI=1S/C19H27N3O3/c1-5-6-9-12-20-16(23)15-17(24)21-14-11-8-7-10-13(14)18(25)22(15)19(2,3)4/h7-8,10-11,15H,5-6,9,12H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | VURWULGBBTXKHJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|