About 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride
4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride (PubChem CID 5338423) has the molecular formula C15H16ClNO2
and a molecular weight of 277.75 g/mol. Its IUPAC name is 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride |
| PubChem CID | 5338423 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride |
| SMILES | COc1cccc(/C=C/c2ccncc2)c1OC.Cl |
| InChI | InChI=1S/C15H15NO2.ClH/c1-17-14-5-3-4-13(15(14)18-2)7-6-12-8-10-16-11-9-12;/h3-11H,1-2H3;1H/b7-6+; |
| InChIKey | GRIFLPWVNPSMPW-UHDJGPCESA-N |
| XLogP | 3.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride?
The IUPAC name of 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride (CID 5338423) is 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride.
What is the SMILES notation for 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride?
The canonical SMILES for 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride is COc1cccc(/C=C/c2ccncc2)c1OC.Cl.
What is the InChIKey of 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride?
The InChIKey is GRIFLPWVNPSMPW-UHDJGPCESA-N. The full InChI is InChI=1S/C15H15NO2.ClH/c1-17-14-5-3-4-13(15(14)18-2)7-6-12-8-10-16-11-9-12;/h3-11H,1-2H3;1H/b7-6+;.
What are the key properties of 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride?
4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride has a molecular weight of 277.75 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]pyridine;hydrochloride is sourced from PubChem (CID 5338423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).